C16H15BrN2O3S — CID 135624657
2-[(2-bromophenyl)methylsulfanyl]-N-[(E)-(2,4-dihydroxyphenyl)methylideneamino]acetamide (PubChem CID 135624657) has the molecular formula C16H15BrN2O3S and a molecular weight of 395.28 g/mol. Its IUPAC name is 2-[(2-bromophenyl)methylsulfanyl]-N-[(E)-(2,4-dihydroxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[(2-bromophenyl)methylsulfanyl]-N-[(E)-(2,4-dihydroxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 135624657 |
| Molecular Formula | C16H15BrN2O3S |
| Molecular Weight | 395.28 g/mol |
| Exact Mass | 394.00 |
| IUPAC Name | 2-[(2-bromophenyl)methylsulfanyl]-N-[(E)-(2,4-dihydroxyphenyl)methylideneamino]acetamide |
| SMILES | O=C(CSCc1ccccc1Br)N/N=C/c1ccc(O)cc1O |
| InChI | InChI=1S/C16H15BrN2O3S/c17-14-4-2-1-3-12(14)9-23-10-16(22)19-18-8-11-5-6-13(20)7-15(11)21/h1-8,20-21H,9-10H2,(H,19,22)/b18-8+ |
| InChIKey | RZHQWUSQNXFZNK-QGMBQPNBSA-N |
| XLogP | 3.24 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.28 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|