C22H26N4O6 — CID 4632012
N,N'-bis[(2,4-dihydroxyphenyl)methylideneamino]octanediamide (PubChem CID 4632012) has the molecular formula C22H26N4O6 and a molecular weight of 442.47 g/mol. Its IUPAC name is N,N'-bis[(2,4-dihydroxyphenyl)methylideneamino]octanediamide.
| Compound Name | N,N'-bis[(2,4-dihydroxyphenyl)methylideneamino]octanediamide |
|---|---|
| PubChem CID | 4632012 |
| Molecular Formula | C22H26N4O6 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | N,N'-bis[(2,4-dihydroxyphenyl)methylideneamino]octanediamide |
| SMILES | O=C(CCCCCCC(=O)NN=Cc1ccc(O)cc1O)NN=Cc1ccc(O)cc1O |
| InChI | InChI=1S/C22H26N4O6/c27-17-9-7-15(19(29)11-17)13-23-25-21(31)5-3-1-2-4-6-22(32)26-24-14-16-8-10-18(28)12-20(16)30/h7-14,27-30H,1-6H2,(H,25,31)(H,26,32) |
| InChIKey | LXYNRMXLWZOADB-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 163.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|