C24H30N4O4 — CID 135555032
N,N'-bis[(E)-(2-hydroxyphenyl)methylideneamino]decanediamide (PubChem CID 135555032) has the molecular formula C24H30N4O4 and a molecular weight of 438.53 g/mol. Its IUPAC name is N,N'-bis[(E)-(2-hydroxyphenyl)methylideneamino]decanediamide.
| Compound Name | N,N'-bis[(E)-(2-hydroxyphenyl)methylideneamino]decanediamide |
|---|---|
| PubChem CID | 135555032 |
| Molecular Formula | C24H30N4O4 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | N,N'-bis[(E)-(2-hydroxyphenyl)methylideneamino]decanediamide |
| SMILES | O=C(CCCCCCCCC(=O)N/N=C/c1ccccc1O)N/N=C/c1ccccc1O |
| InChI | InChI=1S/C24H30N4O4/c29-21-13-9-7-11-19(21)17-25-27-23(31)15-5-3-1-2-4-6-16-24(32)28-26-18-20-12-8-10-14-22(20)30/h7-14,17-18,29-30H,1-6,15-16H2,(H,27,31)(H,28,32)/b25-17+,26-18+ |
| InChIKey | FAGCLRMEOSNCKD-RPCRKUJJSA-N |
| XLogP | 3.82 |
| TPSA | 123.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|