C10H9N2O4- — CID 135683195
3-[(2E)-2-[(2-hydroxyphenyl)methylidene]hydrazinyl]-3-oxopropanoate (PubChem CID 135683195) has the molecular formula C10H9N2O4- and a molecular weight of 221.19 g/mol. Its IUPAC name is 3-[(2E)-2-[(2-hydroxyphenyl)methylidene]hydrazinyl]-3-oxopropanoate.
| Compound Name | 3-[(2E)-2-[(2-hydroxyphenyl)methylidene]hydrazinyl]-3-oxopropanoate |
|---|---|
| PubChem CID | 135683195 |
| Molecular Formula | C10H9N2O4- |
| Molecular Weight | 221.19 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | 3-[(2E)-2-[(2-hydroxyphenyl)methylidene]hydrazinyl]-3-oxopropanoate |
| SMILES | O=C([O-])CC(=O)N/N=C/c1ccccc1O |
| InChI | InChI=1S/C10H10N2O4/c13-8-4-2-1-3-7(8)6-11-12-9(14)5-10(15)16/h1-4,6,13H,5H2,(H,12,14)(H,15,16)/p-1/b11-6+ |
| InChIKey | UUNVNVPEIRSIJL-IZZDOVSWSA-M |
| XLogP | -1.02 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.19 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|