C18H18N6O5 — CID 135747209
N-[(E)-(2-hydroxyphenyl)methylideneamino]-2-[[2-[(2E)-2-[(2-hydroxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-nitrosoamino]acetamide (PubChem CID 135747209) has the molecular formula C18H18N6O5 and a molecular weight of 398.38 g/mol. Its IUPAC name is N-[(E)-(2-hydroxyphenyl)methylideneamino]-2-[[2-[(2E)-2-[(2-hydroxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-nitrosoamino]acetamide.
| Compound Name | N-[(E)-(2-hydroxyphenyl)methylideneamino]-2-[[2-[(2E)-2-[(2-hydroxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-nitrosoamino]acetamide |
|---|---|
| PubChem CID | 135747209 |
| Molecular Formula | C18H18N6O5 |
| Molecular Weight | 398.38 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | N-[(E)-(2-hydroxyphenyl)methylideneamino]-2-[[2-[(2E)-2-[(2-hydroxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-nitrosoamino]acetamide |
| SMILES | O=NN(CC(=O)N/N=C/c1ccccc1O)CC(=O)N/N=C/c1ccccc1O |
| InChI | InChI=1S/C18H18N6O5/c25-15-7-3-1-5-13(15)9-19-21-17(27)11-24(23-29)12-18(28)22-20-10-14-6-2-4-8-16(14)26/h1-10,25-26H,11-12H2,(H,21,27)(H,22,28)/b19-9+,20-10+ |
| InChIKey | NCHWFUJCPSDCAD-LQGKIZFRSA-N |
| XLogP | 0.68 |
| TPSA | 156.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.38 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|