C8H9N3O2 — CID 135741564
[(Z)-(2-hydroxyphenyl)methylideneamino]urea (PubChem CID 135741564) has the molecular formula C8H9N3O2 and a molecular weight of 179.18 g/mol. Its IUPAC name is [(Z)-(2-hydroxyphenyl)methylideneamino]urea.
| Compound Name | [(Z)-(2-hydroxyphenyl)methylideneamino]urea |
|---|---|
| PubChem CID | 135741564 |
| Molecular Formula | C8H9N3O2 |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | [(Z)-(2-hydroxyphenyl)methylideneamino]urea |
| SMILES | NC(=O)N/N=C\c1ccccc1O |
| InChI | InChI=1S/C8H9N3O2/c9-8(13)11-10-5-6-3-1-2-4-7(6)12/h1-5,12H,(H3,9,11,13)/b10-5- |
| InChIKey | IZXDQSKCOWSUOG-YHYXMXQVSA-N |
| XLogP | 0.39 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|