C8H9N3O3 — CID 5052012
[(2,5-dihydroxyphenyl)methylideneamino]urea (PubChem CID 5052012) has the molecular formula C8H9N3O3 and a molecular weight of 195.18 g/mol. Its IUPAC name is [(2,5-dihydroxyphenyl)methylideneamino]urea.
| Compound Name | [(2,5-dihydroxyphenyl)methylideneamino]urea |
|---|---|
| PubChem CID | 5052012 |
| Molecular Formula | C8H9N3O3 |
| Molecular Weight | 195.18 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | [(2,5-dihydroxyphenyl)methylideneamino]urea |
| SMILES | NC(=O)NN=Cc1cc(O)ccc1O |
| InChI | InChI=1S/C8H9N3O3/c9-8(14)11-10-4-5-3-6(12)1-2-7(5)13/h1-4,12-13H,(H3,9,11,14) |
| InChIKey | VKOFPWDMYSJIFA-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.18 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|