C10H12N2O3 — CID 135478857
ethyl N-[(E)-(2-hydroxyphenyl)methylideneamino]carbamate (PubChem CID 135478857) has the molecular formula C10H12N2O3 and a molecular weight of 208.22 g/mol. Its IUPAC name is ethyl N-[(E)-(2-hydroxyphenyl)methylideneamino]carbamate.
| Compound Name | ethyl N-[(E)-(2-hydroxyphenyl)methylideneamino]carbamate |
|---|---|
| PubChem CID | 135478857 |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | ethyl N-[(E)-(2-hydroxyphenyl)methylideneamino]carbamate |
| SMILES | CCOC(=O)N/N=C/c1ccccc1O |
| InChI | InChI=1S/C10H12N2O3/c1-2-15-10(14)12-11-7-8-5-3-4-6-9(8)13/h3-7,13H,2H2,1H3,(H,12,14)/b11-7+ |
| InChIKey | SRFNPEDVDROBQF-YRNVUSSQSA-N |
| XLogP | 1.47 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|