C10H10F2N2O2 — CID 6902012
ethyl N-[(E)-(2,6-difluorophenyl)methylideneamino]carbamate (PubChem CID 6902012) has the molecular formula C10H10F2N2O2 and a molecular weight of 228.20 g/mol. Its IUPAC name is ethyl N-[(E)-(2,6-difluorophenyl)methylideneamino]carbamate.
| Compound Name | ethyl N-[(E)-(2,6-difluorophenyl)methylideneamino]carbamate |
|---|---|
| PubChem CID | 6902012 |
| Molecular Formula | C10H10F2N2O2 |
| Molecular Weight | 228.20 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | ethyl N-[(E)-(2,6-difluorophenyl)methylideneamino]carbamate |
| SMILES | CCOC(=O)N/N=C/c1c(F)cccc1F |
| InChI | InChI=1S/C10H10F2N2O2/c1-2-16-10(15)14-13-6-7-8(11)4-3-5-9(7)12/h3-6H,2H2,1H3,(H,14,15)/b13-6+ |
| InChIKey | NVSBWGFBOPDHST-AWNIVKPZSA-N |
| XLogP | 2.04 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.20 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|