C11H14N2O2 — CID 6861612
ethyl N-[(E)-(2-methylphenyl)methylideneamino]carbamate (PubChem CID 6861612) has the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. Its IUPAC name is ethyl N-[(E)-(2-methylphenyl)methylideneamino]carbamate.
| Compound Name | ethyl N-[(E)-(2-methylphenyl)methylideneamino]carbamate |
|---|---|
| PubChem CID | 6861612 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | ethyl N-[(E)-(2-methylphenyl)methylideneamino]carbamate |
| SMILES | CCOC(=O)N/N=C/c1ccccc1C |
| InChI | InChI=1S/C11H14N2O2/c1-3-15-11(14)13-12-8-10-7-5-4-6-9(10)2/h4-8H,3H2,1-2H3,(H,13,14)/b12-8+ |
| InChIKey | DAVYYRWYGOSNOL-XYOKQWHBSA-N |
| XLogP | 2.08 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|