C12H13N2O5- — CID 7612645
2-[2-[(Z)-(ethoxycarbonylhydrazinylidene)methyl]phenoxy]acetate (PubChem CID 7612645) has the molecular formula C12H13N2O5- and a molecular weight of 265.25 g/mol. Its IUPAC name is 2-[2-[(Z)-(ethoxycarbonylhydrazinylidene)methyl]phenoxy]acetate.
| Compound Name | 2-[2-[(Z)-(ethoxycarbonylhydrazinylidene)methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 7612645 |
| Molecular Formula | C12H13N2O5- |
| Molecular Weight | 265.25 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | 2-[2-[(Z)-(ethoxycarbonylhydrazinylidene)methyl]phenoxy]acetate |
| SMILES | CCOC(=O)N/N=C\c1ccccc1OCC(=O)[O-] |
| InChI | InChI=1S/C12H14N2O5/c1-2-18-12(17)14-13-7-9-5-3-4-6-10(9)19-8-11(15)16/h3-7H,2,8H2,1H3,(H,14,17)(H,15,16)/p-1/b13-7- |
| InChIKey | LUGVCIWDBGHELL-QPEQYQDCSA-M |
| XLogP | -0.10 |
| TPSA | 100.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.25 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|