C16H13N2O5- — CID 2306178
2-[2-[[(4-hydroxybenzoyl)hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 2306178) has the molecular formula C16H13N2O5- and a molecular weight of 313.29 g/mol. Its IUPAC name is 2-[2-[[(4-hydroxybenzoyl)hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | 2-[2-[[(4-hydroxybenzoyl)hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 2306178 |
| Molecular Formula | C16H13N2O5- |
| Molecular Weight | 313.29 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 2-[2-[[(4-hydroxybenzoyl)hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | O=C([O-])COc1ccccc1C=NNC(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C16H14N2O5/c19-13-7-5-11(6-8-13)16(22)18-17-9-12-3-1-2-4-14(12)23-10-15(20)21/h1-9,19H,10H2,(H,18,22)(H,20,21)/p-1 |
| InChIKey | XSKARGLNLJQZKF-UHFFFAOYSA-M |
| XLogP | 0.28 |
| TPSA | 111.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.29 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|