C11H11N2O5- — CID 7341340
2-[2-[(Z)-(methoxycarbonylhydrazinylidene)methyl]phenoxy]acetate (PubChem CID 7341340) has the molecular formula C11H11N2O5- and a molecular weight of 251.22 g/mol. Its IUPAC name is 2-[2-[(Z)-(methoxycarbonylhydrazinylidene)methyl]phenoxy]acetate.
| Compound Name | 2-[2-[(Z)-(methoxycarbonylhydrazinylidene)methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 7341340 |
| Molecular Formula | C11H11N2O5- |
| Molecular Weight | 251.22 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 2-[2-[(Z)-(methoxycarbonylhydrazinylidene)methyl]phenoxy]acetate |
| SMILES | COC(=O)N/N=C\c1ccccc1OCC(=O)[O-] |
| InChI | InChI=1S/C11H12N2O5/c1-17-11(16)13-12-6-8-4-2-3-5-9(8)18-7-10(14)15/h2-6H,7H2,1H3,(H,13,16)(H,14,15)/p-1/b12-6- |
| InChIKey | VEDYKCARTQXLMH-SDQBBNPISA-M |
| XLogP | -0.49 |
| TPSA | 100.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.22 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|