C17H14BrN2O4- — CID 6978889
2-[2-[(Z)-[[2-(4-bromophenyl)acetyl]hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 6978889) has the molecular formula C17H14BrN2O4- and a molecular weight of 390.21 g/mol. Its IUPAC name is 2-[2-[(Z)-[[2-(4-bromophenyl)acetyl]hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | 2-[2-[(Z)-[[2-(4-bromophenyl)acetyl]hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 6978889 |
| Molecular Formula | C17H14BrN2O4- |
| Molecular Weight | 390.21 g/mol |
| Exact Mass | 389.01 |
| IUPAC Name | 2-[2-[(Z)-[[2-(4-bromophenyl)acetyl]hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | O=C([O-])COc1ccccc1/C=N\NC(=O)Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C17H15BrN2O4/c18-14-7-5-12(6-8-14)9-16(21)20-19-10-13-3-1-2-4-15(13)24-11-17(22)23/h1-8,10H,9,11H2,(H,20,21)(H,22,23)/p-1/b19-10- |
| InChIKey | IQKOTPUJHLCIJE-GRSHGNNSSA-M |
| XLogP | 1.27 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.21 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|