C21H17BrN2O4 — CID 5344196
2-[2-[(E)-[[2-(4-bromonaphthalen-1-yl)acetyl]hydrazinylidene]methyl]phenoxy]acetic acid (PubChem CID 5344196) has the molecular formula C21H17BrN2O4 and a molecular weight of 441.28 g/mol. Its IUPAC name is 2-[2-[(E)-[[2-(4-bromonaphthalen-1-yl)acetyl]hydrazinylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2-[(E)-[[2-(4-bromonaphthalen-1-yl)acetyl]hydrazinylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 5344196 |
| Molecular Formula | C21H17BrN2O4 |
| Molecular Weight | 441.28 g/mol |
| Exact Mass | 440.04 |
| IUPAC Name | 2-[2-[(E)-[[2-(4-bromonaphthalen-1-yl)acetyl]hydrazinylidene]methyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccccc1/C=N/NC(=O)Cc1ccc(Br)c2ccccc12 |
| InChI | InChI=1S/C21H17BrN2O4/c22-18-10-9-14(16-6-2-3-7-17(16)18)11-20(25)24-23-12-15-5-1-4-8-19(15)28-13-21(26)27/h1-10,12H,11,13H2,(H,24,25)(H,26,27)/b23-12+ |
| InChIKey | TWCBYANHVINUMV-FSJBWODESA-N |
| XLogP | 3.76 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.28 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|