C17H16N3O3S- — CID 7933533
2-[2-[(Z)-[(2-methylphenyl)carbamothioylhydrazinylidene]methyl]phenoxy]acetate (PubChem CID 7933533) has the molecular formula C17H16N3O3S- and a molecular weight of 342.40 g/mol. Its IUPAC name is 2-[2-[(Z)-[(2-methylphenyl)carbamothioylhydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | 2-[2-[(Z)-[(2-methylphenyl)carbamothioylhydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 7933533 |
| Molecular Formula | C17H16N3O3S- |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 2-[2-[(Z)-[(2-methylphenyl)carbamothioylhydrazinylidene]methyl]phenoxy]acetate |
| SMILES | Cc1ccccc1NC(=S)N/N=C\c1ccccc1OCC(=O)[O-] |
| InChI | InChI=1S/C17H17N3O3S/c1-12-6-2-4-8-14(12)19-17(24)20-18-10-13-7-3-5-9-15(13)23-11-16(21)22/h2-10H,11H2,1H3,(H,21,22)(H2,19,20,24)/p-1/b18-10- |
| InChIKey | IOLJMXCCZRPHHA-ZDLGFXPLSA-M |
| XLogP | 1.44 |
| TPSA | 85.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|