C14H14N2O2 — CID 5399199
ethyl N-[(Z)-naphthalen-1-ylmethylideneamino]carbamate (PubChem CID 5399199) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is ethyl N-[(Z)-naphthalen-1-ylmethylideneamino]carbamate.
| Compound Name | ethyl N-[(Z)-naphthalen-1-ylmethylideneamino]carbamate |
|---|---|
| PubChem CID | 5399199 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | ethyl N-[(Z)-naphthalen-1-ylmethylideneamino]carbamate |
| SMILES | CCOC(=O)N/N=C\c1cccc2ccccc12 |
| InChI | InChI=1S/C14H14N2O2/c1-2-18-14(17)16-15-10-12-8-5-7-11-6-3-4-9-13(11)12/h3-10H,2H2,1H3,(H,16,17)/b15-10- |
| InChIKey | ZIEALNVREIYYPG-GDNBJRDFSA-N |
| XLogP | 2.92 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|