C26H22N4O2 — CID 92959506
N-[(E)-naphthalen-1-ylmethylideneamino]-N'-[(Z)-naphthalen-1-ylmethylideneamino]butanediamide (PubChem CID 92959506) has the molecular formula C26H22N4O2 and a molecular weight of 422.49 g/mol. Its IUPAC name is N-[(E)-naphthalen-1-ylmethylideneamino]-N'-[(Z)-naphthalen-1-ylmethylideneamino]butanediamide.
| Compound Name | N-[(E)-naphthalen-1-ylmethylideneamino]-N'-[(Z)-naphthalen-1-ylmethylideneamino]butanediamide |
|---|---|
| PubChem CID | 92959506 |
| Molecular Formula | C26H22N4O2 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | N-[(E)-naphthalen-1-ylmethylideneamino]-N'-[(Z)-naphthalen-1-ylmethylideneamino]butanediamide |
| SMILES | O=C(CCC(=O)N/N=C/c1cccc2ccccc12)N/N=C\c1cccc2ccccc12 |
| InChI | InChI=1S/C26H22N4O2/c31-25(29-27-17-21-11-5-9-19-7-1-3-13-23(19)21)15-16-26(32)30-28-18-22-12-6-10-20-8-2-4-14-24(20)22/h1-14,17-18H,15-16H2,(H,29,31)(H,30,32)/b27-17-,28-18+ |
| InChIKey | PKORXWIBWKYUDY-HJVIKEODSA-N |
| XLogP | 4.37 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|