C27H24N4O4 — CID 4547663
N,N'-bis[(1-hydroxynaphthalen-2-yl)methylideneamino]pentanediamide (PubChem CID 4547663) has the molecular formula C27H24N4O4 and a molecular weight of 468.51 g/mol. Its IUPAC name is N,N'-bis[(1-hydroxynaphthalen-2-yl)methylideneamino]pentanediamide.
| Compound Name | N,N'-bis[(1-hydroxynaphthalen-2-yl)methylideneamino]pentanediamide |
|---|---|
| PubChem CID | 4547663 |
| Molecular Formula | C27H24N4O4 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | N,N'-bis[(1-hydroxynaphthalen-2-yl)methylideneamino]pentanediamide |
| SMILES | O=C(CCCC(=O)NN=Cc1ccc2ccccc2c1O)NN=Cc1ccc2ccccc2c1O |
| InChI | InChI=1S/C27H24N4O4/c32-24(30-28-16-20-14-12-18-6-1-3-8-22(18)26(20)34)10-5-11-25(33)31-29-17-21-15-13-19-7-2-4-9-23(19)27(21)35/h1-4,6-9,12-17,34-35H,5,10-11H2,(H,30,32)(H,31,33) |
| InChIKey | KBSQPDOVRCTPCH-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 123.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|