C28H20N4O5 — CID 135837519
2-N,5-N-bis[(E)-(1-hydroxynaphthalen-2-yl)methylideneamino]furan-2,5-dicarboxamide (PubChem CID 135837519) has the molecular formula C28H20N4O5 and a molecular weight of 492.49 g/mol. Its IUPAC name is 2-N,5-N-bis[(E)-(1-hydroxynaphthalen-2-yl)methylideneamino]furan-2,5-dicarboxamide.
| Compound Name | 2-N,5-N-bis[(E)-(1-hydroxynaphthalen-2-yl)methylideneamino]furan-2,5-dicarboxamide |
|---|---|
| PubChem CID | 135837519 |
| Molecular Formula | C28H20N4O5 |
| Molecular Weight | 492.49 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | 2-N,5-N-bis[(E)-(1-hydroxynaphthalen-2-yl)methylideneamino]furan-2,5-dicarboxamide |
| SMILES | O=C(N/N=C/c1ccc2ccccc2c1O)c1ccc(C(=O)N/N=C/c2ccc3ccccc3c2O)o1 |
| InChI | InChI=1S/C28H20N4O5/c33-25-19(11-9-17-5-1-3-7-21(17)25)15-29-31-27(35)23-13-14-24(37-23)28(36)32-30-16-20-12-10-18-6-2-4-8-22(18)26(20)34/h1-16,33-34H,(H,31,35)(H,32,36)/b29-15+,30-16+ |
| InChIKey | BKDFAIYEMJQGOR-CMNXJCJSSA-N |
| XLogP | 4.53 |
| TPSA | 136.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.49 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|