C20H18N2O2 — CID 4252787
N-[(1-hydroxynaphthalen-2-yl)methylideneamino]-3,4-dimethylbenzamide (PubChem CID 4252787) has the molecular formula C20H18N2O2 and a molecular weight of 318.38 g/mol. Its IUPAC name is N-[(1-hydroxynaphthalen-2-yl)methylideneamino]-3,4-dimethylbenzamide.
| Compound Name | N-[(1-hydroxynaphthalen-2-yl)methylideneamino]-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 4252787 |
| Molecular Formula | C20H18N2O2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | N-[(1-hydroxynaphthalen-2-yl)methylideneamino]-3,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)NN=Cc2ccc3ccccc3c2O)cc1C |
| InChI | InChI=1S/C20H18N2O2/c1-13-7-8-16(11-14(13)2)20(24)22-21-12-17-10-9-15-5-3-4-6-18(15)19(17)23/h3-12,23H,1-2H3,(H,22,24) |
| InChIKey | AXIIVJQLZCWFAC-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|