C18H12Cl2N2O2 — CID 136750620
2,4-dichloro-N-[(Z)-(1-hydroxynaphthalen-2-yl)methylideneamino]benzamide (PubChem CID 136750620) has the molecular formula C18H12Cl2N2O2 and a molecular weight of 359.21 g/mol. Its IUPAC name is 2,4-dichloro-N-[(Z)-(1-hydroxynaphthalen-2-yl)methylideneamino]benzamide.
| Compound Name | 2,4-dichloro-N-[(Z)-(1-hydroxynaphthalen-2-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 136750620 |
| Molecular Formula | C18H12Cl2N2O2 |
| Molecular Weight | 359.21 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | 2,4-dichloro-N-[(Z)-(1-hydroxynaphthalen-2-yl)methylideneamino]benzamide |
| SMILES | O=C(N/N=C\c1ccc2ccccc2c1O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H12Cl2N2O2/c19-13-7-8-15(16(20)9-13)18(24)22-21-10-12-6-5-11-3-1-2-4-14(11)17(12)23/h1-10,23H,(H,22,24)/b21-10- |
| InChIKey | HBRUGLRUYJOUMU-FBHDLOMBSA-N |
| XLogP | 4.62 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.21 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|