C14H8BrCl3N2O2 — CID 136904981
N-[(Z)-(3-bromo-5-chloro-2-hydroxyphenyl)methylideneamino]-2,4-dichlorobenzamide (PubChem CID 136904981) has the molecular formula C14H8BrCl3N2O2 and a molecular weight of 422.49 g/mol. Its IUPAC name is N-[(Z)-(3-bromo-5-chloro-2-hydroxyphenyl)methylideneamino]-2,4-dichlorobenzamide.
| Compound Name | N-[(Z)-(3-bromo-5-chloro-2-hydroxyphenyl)methylideneamino]-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 136904981 |
| Molecular Formula | C14H8BrCl3N2O2 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 419.88 |
| IUPAC Name | N-[(Z)-(3-bromo-5-chloro-2-hydroxyphenyl)methylideneamino]-2,4-dichlorobenzamide |
| SMILES | O=C(N/N=C\c1cc(Cl)cc(Br)c1O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H8BrCl3N2O2/c15-11-4-9(17)3-7(13(11)21)6-19-20-14(22)10-2-1-8(16)5-12(10)18/h1-6,21H,(H,20,22)/b19-6- |
| InChIKey | YYIGQRMWYDMJNC-SWNXQHNESA-N |
| XLogP | 4.88 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|