C12H7BrCl2N2O2 — CID 126007261
N-[(Z)-(5-bromofuran-2-yl)methylideneamino]-2,4-dichlorobenzamide (PubChem CID 126007261) has the molecular formula C12H7BrCl2N2O2 and a molecular weight of 362.01 g/mol. Its IUPAC name is N-[(Z)-(5-bromofuran-2-yl)methylideneamino]-2,4-dichlorobenzamide.
| Compound Name | N-[(Z)-(5-bromofuran-2-yl)methylideneamino]-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 126007261 |
| Molecular Formula | C12H7BrCl2N2O2 |
| Molecular Weight | 362.01 g/mol |
| Exact Mass | 359.91 |
| IUPAC Name | N-[(Z)-(5-bromofuran-2-yl)methylideneamino]-2,4-dichlorobenzamide |
| SMILES | O=C(N/N=C\c1ccc(Br)o1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H7BrCl2N2O2/c13-11-4-2-8(19-11)6-16-17-12(18)9-3-1-7(14)5-10(9)15/h1-6H,(H,17,18)/b16-6- |
| InChIKey | URJFUAVIEFGCQD-SOFYXZRVSA-N |
| XLogP | 4.11 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.01 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|