C13H9Cl2N5O5 — CID 73053560
1-[(2,4-dichlorobenzoyl)amino]-3-[(E)-(5-nitrofuran-2-yl)methylideneamino]urea (PubChem CID 73053560) has the molecular formula C13H9Cl2N5O5 and a molecular weight of 386.15 g/mol. Its IUPAC name is 1-[(2,4-dichlorobenzoyl)amino]-3-[(E)-(5-nitrofuran-2-yl)methylideneamino]urea.
| Compound Name | 1-[(2,4-dichlorobenzoyl)amino]-3-[(E)-(5-nitrofuran-2-yl)methylideneamino]urea |
|---|---|
| PubChem CID | 73053560 |
| Molecular Formula | C13H9Cl2N5O5 |
| Molecular Weight | 386.15 g/mol |
| Exact Mass | 385.00 |
| IUPAC Name | 1-[(2,4-dichlorobenzoyl)amino]-3-[(E)-(5-nitrofuran-2-yl)methylideneamino]urea |
| SMILES | O=C(N/N=C/c1ccc([N+](=O)[O-])o1)NNC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H9Cl2N5O5/c14-7-1-3-9(10(15)5-7)12(21)17-19-13(22)18-16-6-8-2-4-11(25-8)20(23)24/h1-6H,(H,17,21)(H2,18,19,22)/b16-6+ |
| InChIKey | FBBPCYPLKAEMGH-OMCISZLKSA-N |
| XLogP | 2.47 |
| TPSA | 138.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.15 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|