C20H13Cl2N3O5 — CID 1359375
N-[3-anilino-1-(5-nitrofuran-2-yl)-3-oxoprop-1-en-2-yl]-2,4-dichlorobenzamide (PubChem CID 1359375) has the molecular formula C20H13Cl2N3O5 and a molecular weight of 446.25 g/mol. Its IUPAC name is N-[3-anilino-1-(5-nitrofuran-2-yl)-3-oxoprop-1-en-2-yl]-2,4-dichlorobenzamide.
| Compound Name | N-[3-anilino-1-(5-nitrofuran-2-yl)-3-oxoprop-1-en-2-yl]-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 1359375 |
| Molecular Formula | C20H13Cl2N3O5 |
| Molecular Weight | 446.25 g/mol |
| Exact Mass | 445.02 |
| IUPAC Name | N-[3-anilino-1-(5-nitrofuran-2-yl)-3-oxoprop-1-en-2-yl]-2,4-dichlorobenzamide |
| SMILES | O=C(Nc1ccccc1)C(=Cc1ccc([N+](=O)[O-])o1)NC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H13Cl2N3O5/c21-12-6-8-15(16(22)10-12)19(26)24-17(11-14-7-9-18(30-14)25(28)29)20(27)23-13-4-2-1-3-5-13/h1-11H,(H,23,27)(H,24,26) |
| InChIKey | ZOHPESZPZYUPME-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.25 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|