C20H14BrN3O5 — CID 5498000
N-[(E)-3-anilino-1-(5-nitrofuran-2-yl)-3-oxoprop-1-en-2-yl]-3-bromobenzamide (PubChem CID 5498000) has the molecular formula C20H14BrN3O5 and a molecular weight of 456.25 g/mol. Its IUPAC name is N-[(E)-3-anilino-1-(5-nitrofuran-2-yl)-3-oxoprop-1-en-2-yl]-3-bromobenzamide.
| Compound Name | N-[(E)-3-anilino-1-(5-nitrofuran-2-yl)-3-oxoprop-1-en-2-yl]-3-bromobenzamide |
|---|---|
| PubChem CID | 5498000 |
| Molecular Formula | C20H14BrN3O5 |
| Molecular Weight | 456.25 g/mol |
| Exact Mass | 455.01 |
| IUPAC Name | N-[(E)-3-anilino-1-(5-nitrofuran-2-yl)-3-oxoprop-1-en-2-yl]-3-bromobenzamide |
| SMILES | O=C(Nc1ccccc1)/C(=C\c1ccc([N+](=O)[O-])o1)NC(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C20H14BrN3O5/c21-14-6-4-5-13(11-14)19(25)23-17(12-16-9-10-18(29-16)24(27)28)20(26)22-15-7-2-1-3-8-15/h1-12H,(H,22,26)(H,23,25)/b17-12+ |
| InChIKey | RIGVSQQGWNPHPK-SFQUDFHCSA-N |
| XLogP | 4.36 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.25 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|