C23H19BrN6O6S — CID 44724378
3-bromo-N-[(Z)-3-[4-(diaminomethylideneamino)sulfonylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 44724378) has the molecular formula C23H19BrN6O6S and a molecular weight of 587.41 g/mol. Its IUPAC name is 3-bromo-N-[(Z)-3-[4-(diaminomethylideneamino)sulfonylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | 3-bromo-N-[(Z)-3-[4-(diaminomethylideneamino)sulfonylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 44724378 |
| Molecular Formula | C23H19BrN6O6S |
| Molecular Weight | 587.41 g/mol |
| Exact Mass | 586.03 |
| IUPAC Name | 3-bromo-N-[(Z)-3-[4-(diaminomethylideneamino)sulfonylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | NC(N)=NS(=O)(=O)c1ccc(NC(=O)/C(=C/c2ccccc2[N+](=O)[O-])NC(=O)c2cccc(Br)c2)cc1 |
| InChI | InChI=1S/C23H19BrN6O6S/c24-16-6-3-5-15(12-16)21(31)28-19(13-14-4-1-2-7-20(14)30(33)34)22(32)27-17-8-10-18(11-9-17)37(35,36)29-23(25)26/h1-13H,(H,27,32)(H,28,31)(H4,25,26,29)/b19-13- |
| InChIKey | HEHFGXGQVBHCRK-UYRXBGFRSA-N |
| XLogP | 2.73 |
| TPSA | 199.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|