C36H28N4O5S — CID 22193268
N-[(Z)-1-(2-nitrophenyl)-3-oxo-3-[4-[2-oxo-2-(N-phenylanilino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 22193268) has the molecular formula C36H28N4O5S and a molecular weight of 628.71 g/mol. Its IUPAC name is N-[(Z)-1-(2-nitrophenyl)-3-oxo-3-[4-[2-oxo-2-(N-phenylanilino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(2-nitrophenyl)-3-oxo-3-[4-[2-oxo-2-(N-phenylanilino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22193268 |
| Molecular Formula | C36H28N4O5S |
| Molecular Weight | 628.71 g/mol |
| Exact Mass | 628.18 |
| IUPAC Name | N-[(Z)-1-(2-nitrophenyl)-3-oxo-3-[4-[2-oxo-2-(N-phenylanilino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1ccc(SCC(=O)N(c2ccccc2)c2ccccc2)cc1)/C(=C/c1ccccc1[N+](=O)[O-])NC(=O)c1ccccc1 |
| InChI | InChI=1S/C36H28N4O5S/c41-34(39(29-15-6-2-7-16-29)30-17-8-3-9-18-30)25-46-31-22-20-28(21-23-31)37-36(43)32(38-35(42)26-12-4-1-5-13-26)24-27-14-10-11-19-33(27)40(44)45/h1-24H,25H2,(H,37,43)(H,38,42)/b32-24- |
| InChIKey | OOLTVWVIFKBNPD-TZHWMEPESA-N |
| XLogP | 7.46 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.71 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|