C34H27N3O3S2 — CID 22193408
N-[(Z)-3-oxo-3-[4-[2-oxo-2-(N-phenylanilino)ethyl]sulfanylanilino]-1-thiophen-3-ylprop-1-en-2-yl]benzamide (PubChem CID 22193408) has the molecular formula C34H27N3O3S2 and a molecular weight of 589.74 g/mol. Its IUPAC name is N-[(Z)-3-oxo-3-[4-[2-oxo-2-(N-phenylanilino)ethyl]sulfanylanilino]-1-thiophen-3-ylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-oxo-3-[4-[2-oxo-2-(N-phenylanilino)ethyl]sulfanylanilino]-1-thiophen-3-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22193408 |
| Molecular Formula | C34H27N3O3S2 |
| Molecular Weight | 589.74 g/mol |
| Exact Mass | 589.15 |
| IUPAC Name | N-[(Z)-3-oxo-3-[4-[2-oxo-2-(N-phenylanilino)ethyl]sulfanylanilino]-1-thiophen-3-ylprop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1ccc(SCC(=O)N(c2ccccc2)c2ccccc2)cc1)/C(=C/c1ccsc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C34H27N3O3S2/c38-32(37(28-12-6-2-7-13-28)29-14-8-3-9-15-29)24-42-30-18-16-27(17-19-30)35-34(40)31(22-25-20-21-41-23-25)36-33(39)26-10-4-1-5-11-26/h1-23H,24H2,(H,35,40)(H,36,39)/b31-22- |
| InChIKey | ZDIJIKZTJQBIAO-VAMRJTSQSA-N |
| XLogP | 7.61 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.74 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|