C27H21FN2O2S2 — CID 22784254
N-[(Z)-3-[4-[(2-fluorophenyl)methylsulfanyl]anilino]-3-oxo-1-thiophen-3-ylprop-1-en-2-yl]benzamide (PubChem CID 22784254) has the molecular formula C27H21FN2O2S2 and a molecular weight of 488.61 g/mol. Its IUPAC name is N-[(Z)-3-[4-[(2-fluorophenyl)methylsulfanyl]anilino]-3-oxo-1-thiophen-3-ylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[(2-fluorophenyl)methylsulfanyl]anilino]-3-oxo-1-thiophen-3-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22784254 |
| Molecular Formula | C27H21FN2O2S2 |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | N-[(Z)-3-[4-[(2-fluorophenyl)methylsulfanyl]anilino]-3-oxo-1-thiophen-3-ylprop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1ccc(SCc2ccccc2F)cc1)/C(=C/c1ccsc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C27H21FN2O2S2/c28-24-9-5-4-8-21(24)18-34-23-12-10-22(11-13-23)29-27(32)25(16-19-14-15-33-17-19)30-26(31)20-6-2-1-3-7-20/h1-17H,18H2,(H,29,32)(H,30,31)/b25-16- |
| InChIKey | YRONDLJJHNEINC-XYGWBWBKSA-N |
| XLogP | 6.59 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|