C32H29FN2O2S — CID 22784194
N-[(Z)-3-[4-[(2-fluorophenyl)methylsulfanyl]anilino]-3-oxo-1-(4-propan-2-ylphenyl)prop-1-en-2-yl]benzamide (PubChem CID 22784194) has the molecular formula C32H29FN2O2S and a molecular weight of 524.66 g/mol. Its IUPAC name is N-[(Z)-3-[4-[(2-fluorophenyl)methylsulfanyl]anilino]-3-oxo-1-(4-propan-2-ylphenyl)prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[(2-fluorophenyl)methylsulfanyl]anilino]-3-oxo-1-(4-propan-2-ylphenyl)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22784194 |
| Molecular Formula | C32H29FN2O2S |
| Molecular Weight | 524.66 g/mol |
| Exact Mass | 524.19 |
| IUPAC Name | N-[(Z)-3-[4-[(2-fluorophenyl)methylsulfanyl]anilino]-3-oxo-1-(4-propan-2-ylphenyl)prop-1-en-2-yl]benzamide |
| SMILES | CC(C)c1ccc(/C=C(\NC(=O)c2ccccc2)C(=O)Nc2ccc(SCc3ccccc3F)cc2)cc1 |
| InChI | InChI=1S/C32H29FN2O2S/c1-22(2)24-14-12-23(13-15-24)20-30(35-31(36)25-8-4-3-5-9-25)32(37)34-27-16-18-28(19-17-27)38-21-26-10-6-7-11-29(26)33/h3-20,22H,21H2,1-2H3,(H,34,37)(H,35,36)/b30-20- |
| InChIKey | PZKXMOAZDFYZBG-COEJQBHMSA-N |
| XLogP | 7.65 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.66 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|