C31H27FN2O4S — CID 19300464
N-[(E)-1-(3,4-dimethoxyphenyl)-3-[3-[(2-fluorophenyl)methylsulfanyl]anilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19300464) has the molecular formula C31H27FN2O4S and a molecular weight of 542.63 g/mol. Its IUPAC name is N-[(E)-1-(3,4-dimethoxyphenyl)-3-[3-[(2-fluorophenyl)methylsulfanyl]anilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-1-(3,4-dimethoxyphenyl)-3-[3-[(2-fluorophenyl)methylsulfanyl]anilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19300464 |
| Molecular Formula | C31H27FN2O4S |
| Molecular Weight | 542.63 g/mol |
| Exact Mass | 542.17 |
| IUPAC Name | N-[(E)-1-(3,4-dimethoxyphenyl)-3-[3-[(2-fluorophenyl)methylsulfanyl]anilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1ccc(/C=C(/NC(=O)c2ccccc2)C(=O)Nc2cccc(SCc3ccccc3F)c2)cc1OC |
| InChI | InChI=1S/C31H27FN2O4S/c1-37-28-16-15-21(18-29(28)38-2)17-27(34-30(35)22-9-4-3-5-10-22)31(36)33-24-12-8-13-25(19-24)39-20-23-11-6-7-14-26(23)32/h3-19H,20H2,1-2H3,(H,33,36)(H,34,35)/b27-17+ |
| InChIKey | IOKGGHDEENSGHA-WPWMEQJKSA-N |
| XLogP | 6.54 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.63 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|