C35H31N3O6S — CID 19300466
N-[(E)-1-(3,4-dimethoxyphenyl)-3-[3-[3-(1,3-dioxoisoindol-2-yl)propylsulfanyl]anilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19300466) has the molecular formula C35H31N3O6S and a molecular weight of 621.72 g/mol. Its IUPAC name is N-[(E)-1-(3,4-dimethoxyphenyl)-3-[3-[3-(1,3-dioxoisoindol-2-yl)propylsulfanyl]anilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-1-(3,4-dimethoxyphenyl)-3-[3-[3-(1,3-dioxoisoindol-2-yl)propylsulfanyl]anilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19300466 |
| Molecular Formula | C35H31N3O6S |
| Molecular Weight | 621.72 g/mol |
| Exact Mass | 621.19 |
| IUPAC Name | N-[(E)-1-(3,4-dimethoxyphenyl)-3-[3-[3-(1,3-dioxoisoindol-2-yl)propylsulfanyl]anilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1ccc(/C=C(/NC(=O)c2ccccc2)C(=O)Nc2cccc(SCCCN3C(=O)c4ccccc4C3=O)c2)cc1OC |
| InChI | InChI=1S/C35H31N3O6S/c1-43-30-17-16-23(21-31(30)44-2)20-29(37-32(39)24-10-4-3-5-11-24)33(40)36-25-12-8-13-26(22-25)45-19-9-18-38-34(41)27-14-6-7-15-28(27)35(38)42/h3-8,10-17,20-22H,9,18-19H2,1-2H3,(H,36,40)(H,37,39)/b29-20+ |
| InChIKey | HIHITYMUXXZPMC-ZTKZIYFRSA-N |
| XLogP | 5.89 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.72 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|