C34H32N2O6S — CID 19301286
N-[(Z)-1-(3,4-dimethoxyphenyl)-3-[3-[2-(4-ethoxyphenyl)-2-oxoethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19301286) has the molecular formula C34H32N2O6S and a molecular weight of 596.71 g/mol. Its IUPAC name is N-[(Z)-1-(3,4-dimethoxyphenyl)-3-[3-[2-(4-ethoxyphenyl)-2-oxoethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(3,4-dimethoxyphenyl)-3-[3-[2-(4-ethoxyphenyl)-2-oxoethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19301286 |
| Molecular Formula | C34H32N2O6S |
| Molecular Weight | 596.71 g/mol |
| Exact Mass | 596.20 |
| IUPAC Name | N-[(Z)-1-(3,4-dimethoxyphenyl)-3-[3-[2-(4-ethoxyphenyl)-2-oxoethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCOc1ccc(C(=O)CSc2cccc(NC(=O)/C(=C/c3ccc(OC)c(OC)c3)NC(=O)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C34H32N2O6S/c1-4-42-27-16-14-24(15-17-27)30(37)22-43-28-12-8-11-26(21-28)35-34(39)29(36-33(38)25-9-6-5-7-10-25)19-23-13-18-31(40-2)32(20-23)41-3/h5-21H,4,22H2,1-3H3,(H,35,39)(H,36,38)/b29-19- |
| InChIKey | JFUBGVNOOFGQHB-CEUNXORHSA-N |
| XLogP | 6.49 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.71 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|