C33H28N2O6S — CID 19301404
N-[(Z)-3-[3-[2-(1,3-benzodioxol-5-yl)-2-oxoethyl]sulfanylanilino]-1-(4-ethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19301404) has the molecular formula C33H28N2O6S and a molecular weight of 580.66 g/mol. Its IUPAC name is N-[(Z)-3-[3-[2-(1,3-benzodioxol-5-yl)-2-oxoethyl]sulfanylanilino]-1-(4-ethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[3-[2-(1,3-benzodioxol-5-yl)-2-oxoethyl]sulfanylanilino]-1-(4-ethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19301404 |
| Molecular Formula | C33H28N2O6S |
| Molecular Weight | 580.66 g/mol |
| Exact Mass | 580.17 |
| IUPAC Name | N-[(Z)-3-[3-[2-(1,3-benzodioxol-5-yl)-2-oxoethyl]sulfanylanilino]-1-(4-ethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCOc1ccc(/C=C(\NC(=O)c2ccccc2)C(=O)Nc2cccc(SCC(=O)c3ccc4c(c3)OCO4)c2)cc1 |
| InChI | InChI=1S/C33H28N2O6S/c1-2-39-26-14-11-22(12-15-26)17-28(35-32(37)23-7-4-3-5-8-23)33(38)34-25-9-6-10-27(19-25)42-20-29(36)24-13-16-30-31(18-24)41-21-40-30/h3-19H,2,20-21H2,1H3,(H,34,38)(H,35,37)/b28-17- |
| InChIKey | ZXQPEXFFQPWDJS-QRQIAZFYSA-N |
| XLogP | 6.20 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.66 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|