C31H23ClN2O5S — CID 19301116
N-[(Z)-3-[3-[2-(1,3-benzodioxol-5-yl)-2-oxoethyl]sulfanylanilino]-1-(2-chlorophenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19301116) has the molecular formula C31H23ClN2O5S and a molecular weight of 571.05 g/mol. Its IUPAC name is N-[(Z)-3-[3-[2-(1,3-benzodioxol-5-yl)-2-oxoethyl]sulfanylanilino]-1-(2-chlorophenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[3-[2-(1,3-benzodioxol-5-yl)-2-oxoethyl]sulfanylanilino]-1-(2-chlorophenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19301116 |
| Molecular Formula | C31H23ClN2O5S |
| Molecular Weight | 571.05 g/mol |
| Exact Mass | 570.10 |
| IUPAC Name | N-[(Z)-3-[3-[2-(1,3-benzodioxol-5-yl)-2-oxoethyl]sulfanylanilino]-1-(2-chlorophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1cccc(SCC(=O)c2ccc3c(c2)OCO3)c1)/C(=C/c1ccccc1Cl)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C31H23ClN2O5S/c32-25-12-5-4-9-21(25)15-26(34-30(36)20-7-2-1-3-8-20)31(37)33-23-10-6-11-24(17-23)40-18-27(35)22-13-14-28-29(16-22)39-19-38-28/h1-17H,18-19H2,(H,33,37)(H,34,36)/b26-15- |
| InChIKey | NUQNIOJKDOLWND-YSMPRRRNSA-N |
| XLogP | 6.45 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.05 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|