C31H23N3O7S — CID 19301170
N-[(Z)-3-[3-[2-(1,3-benzodioxol-5-yl)-2-oxoethyl]sulfanylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19301170) has the molecular formula C31H23N3O7S and a molecular weight of 581.61 g/mol. Its IUPAC name is N-[(Z)-3-[3-[2-(1,3-benzodioxol-5-yl)-2-oxoethyl]sulfanylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[3-[2-(1,3-benzodioxol-5-yl)-2-oxoethyl]sulfanylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19301170 |
| Molecular Formula | C31H23N3O7S |
| Molecular Weight | 581.61 g/mol |
| Exact Mass | 581.13 |
| IUPAC Name | N-[(Z)-3-[3-[2-(1,3-benzodioxol-5-yl)-2-oxoethyl]sulfanylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1cccc(SCC(=O)c2ccc3c(c2)OCO3)c1)/C(=C/c1ccccc1[N+](=O)[O-])NC(=O)c1ccccc1 |
| InChI | InChI=1S/C31H23N3O7S/c35-27(22-13-14-28-29(16-22)41-19-40-28)18-42-24-11-6-10-23(17-24)32-31(37)25(33-30(36)20-7-2-1-3-8-20)15-21-9-4-5-12-26(21)34(38)39/h1-17H,18-19H2,(H,32,37)(H,33,36)/b25-15- |
| InChIKey | QVWGAHXMCYSJID-MYYYXRDXSA-N |
| XLogP | 5.71 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.61 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|