C31H25N5O7S — CID 19306291
N-[(E)-3-[3-[2-(2-methyl-4-nitroanilino)-2-oxoethyl]sulfanylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19306291) has the molecular formula C31H25N5O7S and a molecular weight of 611.64 g/mol. Its IUPAC name is N-[(E)-3-[3-[2-(2-methyl-4-nitroanilino)-2-oxoethyl]sulfanylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[2-(2-methyl-4-nitroanilino)-2-oxoethyl]sulfanylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19306291 |
| Molecular Formula | C31H25N5O7S |
| Molecular Weight | 611.64 g/mol |
| Exact Mass | 611.15 |
| IUPAC Name | N-[(E)-3-[3-[2-(2-methyl-4-nitroanilino)-2-oxoethyl]sulfanylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | Cc1cc([N+](=O)[O-])ccc1NC(=O)CSc1cccc(NC(=O)/C(=C\c2ccccc2[N+](=O)[O-])NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C31H25N5O7S/c1-20-16-24(35(40)41)14-15-26(20)33-29(37)19-44-25-12-7-11-23(18-25)32-31(39)27(34-30(38)21-8-3-2-4-9-21)17-22-10-5-6-13-28(22)36(42)43/h2-18H,19H2,1H3,(H,32,39)(H,33,37)(H,34,38)/b27-17+ |
| InChIKey | FWAROXXBWXZZMV-WPWMEQJKSA-N |
| XLogP | 5.95 |
| TPSA | 173.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.64 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|