C29H22ClN5O5S — CID 19319266
N-[(E)-3-[3-[2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl]sulfanylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19319266) has the molecular formula C29H22ClN5O5S and a molecular weight of 588.05 g/mol. Its IUPAC name is N-[(E)-3-[3-[2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl]sulfanylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl]sulfanylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19319266 |
| Molecular Formula | C29H22ClN5O5S |
| Molecular Weight | 588.05 g/mol |
| Exact Mass | 587.10 |
| IUPAC Name | N-[(E)-3-[3-[2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl]sulfanylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(CSc1cccc(NC(=O)/C(=C\c2ccccc2[N+](=O)[O-])NC(=O)c2ccccc2)c1)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C29H22ClN5O5S/c30-21-13-14-26(31-17-21)34-27(36)18-41-23-11-6-10-22(16-23)32-29(38)24(33-28(37)19-7-2-1-3-8-19)15-20-9-4-5-12-25(20)35(39)40/h1-17H,18H2,(H,32,38)(H,33,37)(H,31,34,36)/b24-15+ |
| InChIKey | QBUUFRXFHKSORO-BUVRLJJBSA-N |
| XLogP | 5.78 |
| TPSA | 143.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.05 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|