C34H26N4O5S — CID 19306278
N-[(E)-3-[3-[2-(naphthalen-1-ylamino)-2-oxoethyl]sulfanylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19306278) has the molecular formula C34H26N4O5S and a molecular weight of 602.67 g/mol. Its IUPAC name is N-[(E)-3-[3-[2-(naphthalen-1-ylamino)-2-oxoethyl]sulfanylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[2-(naphthalen-1-ylamino)-2-oxoethyl]sulfanylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19306278 |
| Molecular Formula | C34H26N4O5S |
| Molecular Weight | 602.67 g/mol |
| Exact Mass | 602.16 |
| IUPAC Name | N-[(E)-3-[3-[2-(naphthalen-1-ylamino)-2-oxoethyl]sulfanylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(CSc1cccc(NC(=O)/C(=C\c2ccccc2[N+](=O)[O-])NC(=O)c2ccccc2)c1)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C34H26N4O5S/c39-32(36-29-18-8-14-23-10-4-6-17-28(23)29)22-44-27-16-9-15-26(21-27)35-34(41)30(37-33(40)24-11-2-1-3-12-24)20-25-13-5-7-19-31(25)38(42)43/h1-21H,22H2,(H,35,41)(H,36,39)(H,37,40)/b30-20+ |
| InChIKey | KRPPHUQRAZDGHQ-TWKHWXDSSA-N |
| XLogP | 6.89 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.67 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|