C30H23ClN4O5S — CID 19306250
N-[(E)-3-[3-[2-(3-chloroanilino)-2-oxoethyl]sulfanylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19306250) has the molecular formula C30H23ClN4O5S and a molecular weight of 587.06 g/mol. Its IUPAC name is N-[(E)-3-[3-[2-(3-chloroanilino)-2-oxoethyl]sulfanylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[2-(3-chloroanilino)-2-oxoethyl]sulfanylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19306250 |
| Molecular Formula | C30H23ClN4O5S |
| Molecular Weight | 587.06 g/mol |
| Exact Mass | 586.11 |
| IUPAC Name | N-[(E)-3-[3-[2-(3-chloroanilino)-2-oxoethyl]sulfanylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(CSc1cccc(NC(=O)/C(=C\c2ccccc2[N+](=O)[O-])NC(=O)c2ccccc2)c1)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C30H23ClN4O5S/c31-22-11-6-12-23(17-22)32-28(36)19-41-25-14-7-13-24(18-25)33-30(38)26(34-29(37)20-8-2-1-3-9-20)16-21-10-4-5-15-27(21)35(39)40/h1-18H,19H2,(H,32,36)(H,33,38)(H,34,37)/b26-16+ |
| InChIKey | BHFQYUVJEXVWEA-WGOQTCKBSA-N |
| XLogP | 6.39 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.06 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|