C34H26ClN3O3S — CID 22188371
N-[(Z)-3-[4-[2-(3-chloroanilino)-2-oxoethyl]sulfanylanilino]-1-naphthalen-1-yl-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 22188371) has the molecular formula C34H26ClN3O3S and a molecular weight of 592.12 g/mol. Its IUPAC name is N-[(Z)-3-[4-[2-(3-chloroanilino)-2-oxoethyl]sulfanylanilino]-1-naphthalen-1-yl-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[2-(3-chloroanilino)-2-oxoethyl]sulfanylanilino]-1-naphthalen-1-yl-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22188371 |
| Molecular Formula | C34H26ClN3O3S |
| Molecular Weight | 592.12 g/mol |
| Exact Mass | 591.14 |
| IUPAC Name | N-[(Z)-3-[4-[2-(3-chloroanilino)-2-oxoethyl]sulfanylanilino]-1-naphthalen-1-yl-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(CSc1ccc(NC(=O)/C(=C/c2cccc3ccccc23)NC(=O)c2ccccc2)cc1)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C34H26ClN3O3S/c35-26-13-7-14-28(21-26)36-32(39)22-42-29-18-16-27(17-19-29)37-34(41)31(38-33(40)24-9-2-1-3-10-24)20-25-12-6-11-23-8-4-5-15-30(23)25/h1-21H,22H2,(H,36,39)(H,37,41)(H,38,40)/b31-20- |
| InChIKey | NSPKCUBLGRNHGX-GTWSWNCMSA-N |
| XLogP | 7.63 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.12 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|