C32H29ClN4O3S — CID 21386303
N-[(Z)-3-[4-[2-(3-chloroanilino)-2-oxoethyl]sulfanylanilino]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 21386303) has the molecular formula C32H29ClN4O3S and a molecular weight of 585.13 g/mol. Its IUPAC name is N-[(Z)-3-[4-[2-(3-chloroanilino)-2-oxoethyl]sulfanylanilino]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[2-(3-chloroanilino)-2-oxoethyl]sulfanylanilino]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 21386303 |
| Molecular Formula | C32H29ClN4O3S |
| Molecular Weight | 585.13 g/mol |
| Exact Mass | 584.16 |
| IUPAC Name | N-[(Z)-3-[4-[2-(3-chloroanilino)-2-oxoethyl]sulfanylanilino]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CN(C)c1ccc(/C=C(\NC(=O)c2ccccc2)C(=O)Nc2ccc(SCC(=O)Nc3cccc(Cl)c3)cc2)cc1 |
| InChI | InChI=1S/C32H29ClN4O3S/c1-37(2)27-15-11-22(12-16-27)19-29(36-31(39)23-7-4-3-5-8-23)32(40)35-25-13-17-28(18-14-25)41-21-30(38)34-26-10-6-9-24(33)20-26/h3-20H,21H2,1-2H3,(H,34,38)(H,35,40)(H,36,39)/b29-19- |
| InChIKey | NAJCLMSHMUQKBW-CEUNXORHSA-N |
| XLogP | 6.55 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.13 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|