C38H34N4O4S — CID 19308599
N-[(E)-1-[4-(dimethylamino)phenyl]-3-oxo-3-[3-[2-oxo-2-(4-phenoxyanilino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 19308599) has the molecular formula C38H34N4O4S and a molecular weight of 642.78 g/mol. Its IUPAC name is N-[(E)-1-[4-(dimethylamino)phenyl]-3-oxo-3-[3-[2-oxo-2-(4-phenoxyanilino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-1-[4-(dimethylamino)phenyl]-3-oxo-3-[3-[2-oxo-2-(4-phenoxyanilino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19308599 |
| Molecular Formula | C38H34N4O4S |
| Molecular Weight | 642.78 g/mol |
| Exact Mass | 642.23 |
| IUPAC Name | N-[(E)-1-[4-(dimethylamino)phenyl]-3-oxo-3-[3-[2-oxo-2-(4-phenoxyanilino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | CN(C)c1ccc(/C=C(/NC(=O)c2ccccc2)C(=O)Nc2cccc(SCC(=O)Nc3ccc(Oc4ccccc4)cc3)c2)cc1 |
| InChI | InChI=1S/C38H34N4O4S/c1-42(2)31-20-16-27(17-21-31)24-35(41-37(44)28-10-5-3-6-11-28)38(45)40-30-12-9-15-34(25-30)47-26-36(43)39-29-18-22-33(23-19-29)46-32-13-7-4-8-14-32/h3-25H,26H2,1-2H3,(H,39,43)(H,40,45)(H,41,44)/b35-24+ |
| InChIKey | DGYYYDDFMGBXMF-JWHWKPFMSA-N |
| XLogP | 7.69 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.78 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|