C39H35N3O5S — CID 19314646
N-[(Z)-3-[3-[2-(4-ethoxyanilino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide (PubChem CID 19314646) has the molecular formula C39H35N3O5S and a molecular weight of 657.79 g/mol. Its IUPAC name is N-[(Z)-3-[3-[2-(4-ethoxyanilino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[3-[2-(4-ethoxyanilino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19314646 |
| Molecular Formula | C39H35N3O5S |
| Molecular Weight | 657.79 g/mol |
| Exact Mass | 657.23 |
| IUPAC Name | N-[(Z)-3-[3-[2-(4-ethoxyanilino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide |
| SMILES | CCOc1ccc(NC(=O)CSc2cccc(NC(=O)/C(=C/c3ccc(OCc4ccccc4)cc3)NC(=O)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C39H35N3O5S/c1-2-46-33-22-18-31(19-23-33)40-37(43)27-48-35-15-9-14-32(25-35)41-39(45)36(42-38(44)30-12-7-4-8-13-30)24-28-16-20-34(21-17-28)47-26-29-10-5-3-6-11-29/h3-25H,2,26-27H2,1H3,(H,40,43)(H,41,45)(H,42,44)/b36-24- |
| InChIKey | CNVKRAYFQUNVKT-IBTHDSTKSA-N |
| XLogP | 7.80 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.79 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|