C38H31N3O4S — CID 19300599
N-[(E)-3-[3-(2-carbazol-9-yl-2-oxoethyl)sulfanylanilino]-1-(4-ethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19300599) has the molecular formula C38H31N3O4S and a molecular weight of 625.75 g/mol. Its IUPAC name is N-[(E)-3-[3-(2-carbazol-9-yl-2-oxoethyl)sulfanylanilino]-1-(4-ethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-(2-carbazol-9-yl-2-oxoethyl)sulfanylanilino]-1-(4-ethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19300599 |
| Molecular Formula | C38H31N3O4S |
| Molecular Weight | 625.75 g/mol |
| Exact Mass | 625.20 |
| IUPAC Name | N-[(E)-3-[3-(2-carbazol-9-yl-2-oxoethyl)sulfanylanilino]-1-(4-ethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCOc1ccc(/C=C(/NC(=O)c2ccccc2)C(=O)Nc2cccc(SCC(=O)n3c4ccccc4c4ccccc43)c2)cc1 |
| InChI | InChI=1S/C38H31N3O4S/c1-2-45-29-21-19-26(20-22-29)23-33(40-37(43)27-11-4-3-5-12-27)38(44)39-28-13-10-14-30(24-28)46-25-36(42)41-34-17-8-6-15-31(34)32-16-7-9-18-35(32)41/h3-24H,2,25H2,1H3,(H,39,44)(H,40,43)/b33-23+ |
| InChIKey | LLVDEVFJDDTCME-GZZLJNBRSA-N |
| XLogP | 8.04 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.75 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|