C43H37N3O4S — CID 19301903
N-[(Z)-3-oxo-3-[3-[2-oxo-2-(1,2,3,4-tetrahydrocarbazol-9-yl)ethyl]sulfanylanilino]-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide (PubChem CID 19301903) has the molecular formula C43H37N3O4S and a molecular weight of 691.85 g/mol. Its IUPAC name is N-[(Z)-3-oxo-3-[3-[2-oxo-2-(1,2,3,4-tetrahydrocarbazol-9-yl)ethyl]sulfanylanilino]-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-oxo-3-[3-[2-oxo-2-(1,2,3,4-tetrahydrocarbazol-9-yl)ethyl]sulfanylanilino]-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19301903 |
| Molecular Formula | C43H37N3O4S |
| Molecular Weight | 691.85 g/mol |
| Exact Mass | 691.25 |
| IUPAC Name | N-[(Z)-3-oxo-3-[3-[2-oxo-2-(1,2,3,4-tetrahydrocarbazol-9-yl)ethyl]sulfanylanilino]-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1cccc(SCC(=O)n2c3c(c4ccccc42)CCCC3)c1)/C(=C/c1ccc(OCc2ccccc2)cc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C43H37N3O4S/c47-41(46-39-20-9-7-18-36(39)37-19-8-10-21-40(37)46)29-51-35-17-11-16-33(27-35)44-43(49)38(45-42(48)32-14-5-2-6-15-32)26-30-22-24-34(25-23-30)50-28-31-12-3-1-4-13-31/h1-7,9,11-18,20,22-27H,8,10,19,21,28-29H2,(H,44,49)(H,45,48)/b38-26- |
| InChIKey | AIXCOPBANIBRPC-HBAMXUDRSA-N |
| XLogP | 8.94 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.85 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|