C36H31N3O3S — CID 22193235
N-[(Z)-3-oxo-3-[4-[2-oxo-2-(1,2,3,4-tetrahydrocarbazol-9-yl)ethyl]sulfanylanilino]-1-phenylprop-1-en-2-yl]benzamide (PubChem CID 22193235) has the molecular formula C36H31N3O3S and a molecular weight of 585.73 g/mol. Its IUPAC name is N-[(Z)-3-oxo-3-[4-[2-oxo-2-(1,2,3,4-tetrahydrocarbazol-9-yl)ethyl]sulfanylanilino]-1-phenylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-oxo-3-[4-[2-oxo-2-(1,2,3,4-tetrahydrocarbazol-9-yl)ethyl]sulfanylanilino]-1-phenylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22193235 |
| Molecular Formula | C36H31N3O3S |
| Molecular Weight | 585.73 g/mol |
| Exact Mass | 585.21 |
| IUPAC Name | N-[(Z)-3-oxo-3-[4-[2-oxo-2-(1,2,3,4-tetrahydrocarbazol-9-yl)ethyl]sulfanylanilino]-1-phenylprop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1ccc(SCC(=O)n2c3c(c4ccccc42)CCCC3)cc1)/C(=C/c1ccccc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C36H31N3O3S/c40-34(39-32-17-9-7-15-29(32)30-16-8-10-18-33(30)39)24-43-28-21-19-27(20-22-28)37-36(42)31(23-25-11-3-1-4-12-25)38-35(41)26-13-5-2-6-14-26/h1-7,9,11-15,17,19-23H,8,10,16,18,24H2,(H,37,42)(H,38,41)/b31-23- |
| InChIKey | QTQZBOMGBIWVIJ-SXBRIOAWSA-N |
| XLogP | 7.36 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.73 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|