C36H30FN3O3S — CID 22193375
N-[(Z)-1-(4-fluorophenyl)-3-oxo-3-[4-[2-oxo-2-(1,2,3,4-tetrahydrocarbazol-9-yl)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 22193375) has the molecular formula C36H30FN3O3S and a molecular weight of 603.72 g/mol. Its IUPAC name is N-[(Z)-1-(4-fluorophenyl)-3-oxo-3-[4-[2-oxo-2-(1,2,3,4-tetrahydrocarbazol-9-yl)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(4-fluorophenyl)-3-oxo-3-[4-[2-oxo-2-(1,2,3,4-tetrahydrocarbazol-9-yl)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22193375 |
| Molecular Formula | C36H30FN3O3S |
| Molecular Weight | 603.72 g/mol |
| Exact Mass | 603.20 |
| IUPAC Name | N-[(Z)-1-(4-fluorophenyl)-3-oxo-3-[4-[2-oxo-2-(1,2,3,4-tetrahydrocarbazol-9-yl)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1ccc(SCC(=O)n2c3c(c4ccccc42)CCCC3)cc1)/C(=C/c1ccc(F)cc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C36H30FN3O3S/c37-26-16-14-24(15-17-26)22-31(39-35(42)25-8-2-1-3-9-25)36(43)38-27-18-20-28(21-19-27)44-23-34(41)40-32-12-6-4-10-29(32)30-11-5-7-13-33(30)40/h1-4,6,8-10,12,14-22H,5,7,11,13,23H2,(H,38,43)(H,39,42)/b31-22- |
| InChIKey | DQIRXUVKTORFTN-VAMRJTSQSA-N |
| XLogP | 7.50 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.72 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|